C17H19ClO3S — CID 111472427
1-(3-chlorophenyl)-2-[(3,5-dimethylphenyl)methylsulfonyl]ethanol (PubChem CID 111472427) has the molecular formula C17H19ClO3S and a molecular weight of 338.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[(3,5-dimethylphenyl)methylsulfonyl]ethanol.
| Compound Name | 1-(3-chlorophenyl)-2-[(3,5-dimethylphenyl)methylsulfonyl]ethanol |
|---|---|
| PubChem CID | 111472427 |
| Molecular Formula | C17H19ClO3S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[(3,5-dimethylphenyl)methylsulfonyl]ethanol |
| SMILES | Cc1cc(C)cc(CS(=O)(=O)CC(O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H19ClO3S/c1-12-6-13(2)8-14(7-12)10-22(20,21)11-17(19)15-4-3-5-16(18)9-15/h3-9,17,19H,10-11H2,1-2H3 |
| InChIKey | QHZVLJMPNKKROG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |