C12H19NO3S — CID 114243947
(2S)-1-amino-3-[(3,5-dimethylphenyl)methylsulfonyl]propan-2-ol (PubChem CID 114243947) has the molecular formula C12H19NO3S and a molecular weight of 257.36 g/mol. Its IUPAC name is (2S)-1-amino-3-[(3,5-dimethylphenyl)methylsulfonyl]propan-2-ol.
| Compound Name | (2S)-1-amino-3-[(3,5-dimethylphenyl)methylsulfonyl]propan-2-ol |
|---|---|
| PubChem CID | 114243947 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (2S)-1-amino-3-[(3,5-dimethylphenyl)methylsulfonyl]propan-2-ol |
| SMILES | Cc1cc(C)cc(CS(=O)(=O)C[C@@H](O)CN)c1 |
| InChI | InChI=1S/C12H19NO3S/c1-9-3-10(2)5-11(4-9)7-17(15,16)8-12(14)6-13/h3-5,12,14H,6-8,13H2,1-2H3/t12-/m0/s1 |
| InChIKey | NYIFIQNDQJELJC-LBPRGKRZSA-N |
| XLogP | 0.54 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |