C12H17ClO2 — CID 83924628
5-(3-chlorophenyl)hexane-2,3-diol (PubChem CID 83924628) has the molecular formula C12H17ClO2 and a molecular weight of 228.72 g/mol. Its IUPAC name is 5-(3-chlorophenyl)hexane-2,3-diol.
| Compound Name | 5-(3-chlorophenyl)hexane-2,3-diol |
|---|---|
| PubChem CID | 83924628 |
| Molecular Formula | C12H17ClO2 |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 5-(3-chlorophenyl)hexane-2,3-diol |
| SMILES | CC(CC(O)C(C)O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H17ClO2/c1-8(6-12(15)9(2)14)10-4-3-5-11(13)7-10/h3-5,7-9,12,14-15H,6H2,1-2H3 |
| InChIKey | XSUGPHDTBVMQGZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |