C20H34O5 — CID 88820617
1,1-diethoxyethane;4-phenylpent-4-enal;propane-1,2-diol (PubChem CID 88820617) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is 1,1-diethoxyethane;4-phenylpent-4-enal;propane-1,2-diol.
| Compound Name | 1,1-diethoxyethane;4-phenylpent-4-enal;propane-1,2-diol |
|---|---|
| PubChem CID | 88820617 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 1,1-diethoxyethane;4-phenylpent-4-enal;propane-1,2-diol |
| SMILES | C=C(CCC=O)c1ccccc1.CC(O)CO.CCOC(C)OCC |
| InChI | InChI=1S/C11H12O.C6H14O2.C3H8O2/c1-10(6-5-9-12)11-7-3-2-4-8-11;1-4-7-6(3)8-5-2;1-3(5)2-4/h2-4,7-9H,1,5-6H2;6H,4-5H2,1-3H3;3-5H,2H2,1H3 |
| InChIKey | IELSRVFDPDVEJW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|