About 1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile
1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile (PubChem CID 87682649) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is 1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile.
Molecular Properties
| Compound Name | 1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile |
| PubChem CID | 87682649 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile |
| SMILES | C=C.CCOC(C)OCC.N#CC(=C=O)C#N |
| InChI | InChI=1S/C6H14O2.C4N2O.C2H4/c1-4-7-6(3)8-5-2;5-1-4(2-6)3-7;1-2/h6H,4-5H2,1-3H3;;1-2H2 |
| InChIKey | MALDAHSHABXONN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile?
The IUPAC name of 1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile (CID 87682649) is 1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile.
What is the SMILES notation for 1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile?
The canonical SMILES for 1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile is C=C.CCOC(C)OCC.N#CC(=C=O)C#N.
What is the InChIKey of 1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile?
The InChIKey is MALDAHSHABXONN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.C4N2O.C2H4/c1-4-7-6(3)8-5-2;5-1-4(2-6)3-7;1-2/h6H,4-5H2,1-3H3;;1-2H2.
What are the key properties of 1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile?
1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile has a molecular weight of 238.29 g/mol, XLogP of 2.00, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethoxyethane;ethene;2-(oxomethylidene)propanedinitrile is sourced from PubChem (CID 87682649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).