C19H24O4 — CID 129388666
(2R)-3,3-diethoxy-1,1-diphenylpropane-1,2-diol (PubChem CID 129388666) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (2R)-3,3-diethoxy-1,1-diphenylpropane-1,2-diol.
| Compound Name | (2R)-3,3-diethoxy-1,1-diphenylpropane-1,2-diol |
|---|---|
| PubChem CID | 129388666 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (2R)-3,3-diethoxy-1,1-diphenylpropane-1,2-diol |
| SMILES | CCOC(OCC)[C@H](O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24O4/c1-3-22-18(23-4-2)17(20)19(21,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17-18,20-21H,3-4H2,1-2H3/t17-/m0/s1 |
| InChIKey | NSWPKYKFCOOOKK-KRWDZBQOSA-N |
| XLogP | 2.68 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|