C17H20FNO3 — CID 57247812
2,2-diethoxy-1-(3-fluoro-4-pyridinyl)-1-phenylethanol (PubChem CID 57247812) has the molecular formula C17H20FNO3 and a molecular weight of 305.35 g/mol. Its IUPAC name is 2,2-diethoxy-1-(3-fluoro-4-pyridinyl)-1-phenylethanol.
| Compound Name | 2,2-diethoxy-1-(3-fluoro-4-pyridinyl)-1-phenylethanol |
|---|---|
| PubChem CID | 57247812 |
| Molecular Formula | C17H20FNO3 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2,2-diethoxy-1-(3-fluoro-4-pyridinyl)-1-phenylethanol |
| SMILES | CCOC(OCC)C(O)(c1ccccc1)c1ccncc1F |
| InChI | InChI=1S/C17H20FNO3/c1-3-21-16(22-4-2)17(20,13-8-6-5-7-9-13)14-10-11-19-12-15(14)18/h5-12,16,20H,3-4H2,1-2H3 |
| InChIKey | BGXIDADCBBGCOI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|