C15H25BrO — CID 162966744
(2S,3Z,6E)-1-bromo-3,7,11-trimethyldodeca-3,6,10-trien-2-ol (PubChem CID 162966744) has the molecular formula C15H25BrO and a molecular weight of 301.27 g/mol. Its IUPAC name is (2S,3Z,6E)-1-bromo-3,7,11-trimethyldodeca-3,6,10-trien-2-ol.
| Compound Name | (2S,3Z,6E)-1-bromo-3,7,11-trimethyldodeca-3,6,10-trien-2-ol |
|---|---|
| PubChem CID | 162966744 |
| Molecular Formula | C15H25BrO |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (2S,3Z,6E)-1-bromo-3,7,11-trimethyldodeca-3,6,10-trien-2-ol |
| SMILES | CC(C)=CCC/C(C)=C/C/C=C(/C)[C@H](O)CBr |
| InChI | InChI=1S/C15H25BrO/c1-12(2)7-5-8-13(3)9-6-10-14(4)15(17)11-16/h7,9-10,15,17H,5-6,8,11H2,1-4H3/b13-9+,14-10-/t15-/m1/s1 |
| InChIKey | BMYRKAKGPSZRBG-CIKDODLPSA-N |
| XLogP | 4.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|