C14H24O4S — CID 89308595
(2E,5E)-1-hydroxy-2,6,10-trimethylundeca-2,5,9-triene-1-sulfonic acid (PubChem CID 89308595) has the molecular formula C14H24O4S and a molecular weight of 288.41 g/mol. Its IUPAC name is (2E,5E)-1-hydroxy-2,6,10-trimethylundeca-2,5,9-triene-1-sulfonic acid.
| Compound Name | (2E,5E)-1-hydroxy-2,6,10-trimethylundeca-2,5,9-triene-1-sulfonic acid |
|---|---|
| PubChem CID | 89308595 |
| Molecular Formula | C14H24O4S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (2E,5E)-1-hydroxy-2,6,10-trimethylundeca-2,5,9-triene-1-sulfonic acid |
| SMILES | CC(C)=CCC/C(C)=C/C/C=C(\C)C(O)S(=O)(=O)O |
| InChI | InChI=1S/C14H24O4S/c1-11(2)7-5-8-12(3)9-6-10-13(4)14(15)19(16,17)18/h7,9-10,14-15H,5-6,8H2,1-4H3,(H,16,17,18)/b12-9+,13-10+ |
| InChIKey | JTTCBYOGZNCHTK-JOWSBRCASA-N |
| XLogP | 3.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|