C20H30OSi — CID 154634937
CID 154634937 (PubChem CID 154634937) has the molecular formula C20H30OSi and a molecular weight of 314.55 g/mol.
| Compound Name | CID 154634937 |
|---|---|
| PubChem CID | 154634937 |
| Molecular Formula | C20H30OSi |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | — |
| SMILES | CC(C)=CCC/C(C)=C/COCCCC[Si]c1ccccc1 |
| InChI | InChI=1S/C20H30OSi/c1-18(2)10-9-11-19(3)14-16-21-15-7-8-17-22-20-12-5-4-6-13-20/h4-6,10,12-14H,7-9,11,15-17H2,1-3H3/b19-14+ |
| InChIKey | OXOAMVJHSUQIIH-XMHGGMMESA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|