C19H35N3O — CID 91500196
4,4-diamino-7,11,15-trimethylhexadeca-6,10,14-trienamide (PubChem CID 91500196) has the molecular formula C19H35N3O and a molecular weight of 321.51 g/mol. Its IUPAC name is 4,4-diamino-7,11,15-trimethylhexadeca-6,10,14-trienamide.
| Compound Name | 4,4-diamino-7,11,15-trimethylhexadeca-6,10,14-trienamide |
|---|---|
| PubChem CID | 91500196 |
| Molecular Formula | C19H35N3O |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.28 |
| IUPAC Name | 4,4-diamino-7,11,15-trimethylhexadeca-6,10,14-trienamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCC(N)(N)CCC(N)=O |
| InChI | InChI=1S/C19H35N3O/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-13-19(21,22)14-12-18(20)23/h7,9,11H,5-6,8,10,12-14,21-22H2,1-4H3,(H2,20,23) |
| InChIKey | UPSOLJNNVDGHRH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|