C19H31NO2 — CID 91124399
4-(3,7,11-trimethyldodeca-2,6,10-trienylideneamino)butanoic acid (PubChem CID 91124399) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 4-(3,7,11-trimethyldodeca-2,6,10-trienylideneamino)butanoic acid.
| Compound Name | 4-(3,7,11-trimethyldodeca-2,6,10-trienylideneamino)butanoic acid |
|---|---|
| PubChem CID | 91124399 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 4-(3,7,11-trimethyldodeca-2,6,10-trienylideneamino)butanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=C/C=N/CCCC(=O)O |
| InChI | InChI=1S/C19H31NO2/c1-16(2)8-5-9-17(3)10-6-11-18(4)13-15-20-14-7-12-19(21)22/h8,10,13,15H,5-7,9,11-12,14H2,1-4H3,(H,21,22)/b17-10?,18-13?,20-15+ |
| InChIKey | ZCVSEPMSRFQOFJ-AGEIOZPMSA-N |
| XLogP | 5.34 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|