C31H52N2O6S — CID 58167535
methyl (4E)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[(2-methylpropan-2-yl)oxycarbonylimino]-2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylmethyl]butanoate (PubChem CID 58167535) has the molecular formula C31H52N2O6S and a molecular weight of 580.83 g/mol. Its IUPAC name is methyl (4E)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[(2-methylpropan-2-yl)oxycarbonylimino]-2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylmethyl]butanoate.
| Compound Name | methyl (4E)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[(2-methylpropan-2-yl)oxycarbonylimino]-2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylmethyl]butanoate |
|---|---|
| PubChem CID | 58167535 |
| Molecular Formula | C31H52N2O6S |
| Molecular Weight | 580.83 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | methyl (4E)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[(2-methylpropan-2-yl)oxycarbonylimino]-2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylmethyl]butanoate |
| SMILES | COC(=O)C(CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C/C(=N\C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H52N2O6S/c1-22(2)14-12-15-23(3)16-13-17-24(4)18-19-40-21-25(27(34)37-11)20-26(32-28(35)38-30(5,6)7)33-29(36)39-31(8,9)10/h14,16,18,25H,12-13,15,17,19-21H2,1-11H3,(H,32,33,35,36)/b23-16+,24-18+ |
| InChIKey | XMOQKNPMIXXIPG-LRZMZADRSA-N |
| XLogP | 8.18 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.83 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|