C30H52O — CID 162973522
2,6,10,15,19,23-hexamethyltetracosa-1,5,14,18,22-pentaen-4-ol (PubChem CID 162973522) has the molecular formula C30H52O and a molecular weight of 428.75 g/mol. Its IUPAC name is 2,6,10,15,19,23-hexamethyltetracosa-1,5,14,18,22-pentaen-4-ol.
| Compound Name | 2,6,10,15,19,23-hexamethyltetracosa-1,5,14,18,22-pentaen-4-ol |
|---|---|
| PubChem CID | 162973522 |
| Molecular Formula | C30H52O |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.40 |
| IUPAC Name | 2,6,10,15,19,23-hexamethyltetracosa-1,5,14,18,22-pentaen-4-ol |
| SMILES | C=C(C)CC(O)C=C(C)CCCC(C)CCCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C30H52O/c1-24(2)14-11-17-28(7)19-12-18-26(5)15-9-10-16-27(6)20-13-21-29(8)23-30(31)22-25(3)4/h14-15,19,23,27,30-31H,3,9-13,16-18,20-22H2,1-2,4-8H3 |
| InChIKey | BDDPATXVSPBOGZ-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|