C14H16OS — CID 144623756
2-cyclohexa-1,3-dien-1-yl-2-phenylsulfanylethanol (PubChem CID 144623756) has the molecular formula C14H16OS and a molecular weight of 232.35 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-2-phenylsulfanylethanol.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-2-phenylsulfanylethanol |
|---|---|
| PubChem CID | 144623756 |
| Molecular Formula | C14H16OS |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-2-phenylsulfanylethanol |
| SMILES | OCC(Sc1ccccc1)C1=CC=CCC1 |
| InChI | InChI=1S/C14H16OS/c15-11-14(12-7-3-1-4-8-12)16-13-9-5-2-6-10-13/h1-3,5-7,9-10,14-15H,4,8,11H2 |
| InChIKey | GIMRHWYIPHTGTO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |