About bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+)
bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+) (PubChem CID 173448913) has the molecular formula C26H26Fe
and a molecular weight of 394.34 g/mol. Its IUPAC name is bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+).
Molecular Properties
| Compound Name | bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+) |
| PubChem CID | 173448913 |
| Molecular Formula | C26H26Fe |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+) |
| SMILES | CC(C1=CC=[C-]C1)c1ccccc1.CC(C1=CC=[C-]C1)c1ccccc1.[Fe+2] |
| InChI | InChI=1S/2C13H13.Fe/c2*1-11(13-9-5-6-10-13)12-7-3-2-4-8-12;/h2*2-5,7-9,11H,10H2,1H3;/q2*-1;+2 |
| InChIKey | JYUVBGOKRCJDQI-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+)?
The IUPAC name of bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+) (CID 173448913) is bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+).
What is the SMILES notation for bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+)?
The canonical SMILES for bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+) is CC(C1=CC=[C-]C1)c1ccccc1.CC(C1=CC=[C-]C1)c1ccccc1.[Fe+2].
What is the InChIKey of bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+)?
The InChIKey is JYUVBGOKRCJDQI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H13.Fe/c2*1-11(13-9-5-6-10-13)12-7-3-2-4-8-12;/h2*2-5,7-9,11H,10H2,1H3;/q2*-1;+2.
What are the key properties of bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+)?
bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+) has a molecular weight of 394.34 g/mol, XLogP of 6.96, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-cyclopenta-1,3-dien-1-ylethylbenzene);iron(2+) is sourced from PubChem (CID 173448913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).