C14H16O2P2 — CID 141349618
[2-(2,6-dimethoxyphenyl)-6-phosphanylphenyl]phosphane (PubChem CID 141349618) has the molecular formula C14H16O2P2 and a molecular weight of 278.23 g/mol. Its IUPAC name is [2-(2,6-dimethoxyphenyl)-6-phosphanylphenyl]phosphane.
| Compound Name | [2-(2,6-dimethoxyphenyl)-6-phosphanylphenyl]phosphane |
|---|---|
| PubChem CID | 141349618 |
| Molecular Formula | C14H16O2P2 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | [2-(2,6-dimethoxyphenyl)-6-phosphanylphenyl]phosphane |
| SMILES | COc1cccc(OC)c1-c1cccc(P)c1P |
| InChI | InChI=1S/C14H16O2P2/c1-15-10-6-4-7-11(16-2)13(10)9-5-3-8-12(17)14(9)18/h3-8H,17-18H2,1-2H3 |
| InChIKey | QMSKUILPEUWASI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|