C19H15ClO — CID 89147596
1-(chloromethoxy)-2,3-diphenylbenzene (PubChem CID 89147596) has the molecular formula C19H15ClO and a molecular weight of 294.78 g/mol. Its IUPAC name is 1-(chloromethoxy)-2,3-diphenylbenzene.
| Compound Name | 1-(chloromethoxy)-2,3-diphenylbenzene |
|---|---|
| PubChem CID | 89147596 |
| Molecular Formula | C19H15ClO |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-(chloromethoxy)-2,3-diphenylbenzene |
| SMILES | ClCOc1cccc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H15ClO/c20-14-21-18-13-7-12-17(15-8-3-1-4-9-15)19(18)16-10-5-2-6-11-16/h1-13H,14H2 |
| InChIKey | TYDUYNKUIZRTPT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|