C58H65OP — CID 140524404
tetrakis(4-tert-butylphenyl)-(2,3-diphenylphenoxy)-λ5-phosphane (PubChem CID 140524404) has the molecular formula C58H65OP and a molecular weight of 809.13 g/mol. Its IUPAC name is tetrakis(4-tert-butylphenyl)-(2,3-diphenylphenoxy)-λ5-phosphane.
| Compound Name | tetrakis(4-tert-butylphenyl)-(2,3-diphenylphenoxy)-λ5-phosphane |
|---|---|
| PubChem CID | 140524404 |
| Molecular Formula | C58H65OP |
| Molecular Weight | 809.13 g/mol |
| Exact Mass | 808.48 |
| IUPAC Name | tetrakis(4-tert-butylphenyl)-(2,3-diphenylphenoxy)-λ5-phosphane |
| SMILES | CC(C)(C)c1ccc(P(Oc2cccc(-c3ccccc3)c2-c2ccccc2)(c2ccc(C(C)(C)C)cc2)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C58H65OP/c1-55(2,3)44-26-34-48(35-27-44)60(49-36-28-45(29-37-49)56(4,5)6,50-38-30-46(31-39-50)57(7,8)9,51-40-32-47(33-41-51)58(10,11)12)59-53-25-19-24-52(42-20-15-13-16-21-42)54(53)43-22-17-14-18-23-43/h13-41H,1-12H3 |
| InChIKey | NXUCLGBDYHFDPZ-UHFFFAOYSA-N |
| XLogP | 14.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.13 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|