C31H33P — CID 5013068
2,6-ditert-butyl-4-(2,6-diphenylphenyl)phosphinine (PubChem CID 5013068) has the molecular formula C31H33P and a molecular weight of 436.58 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(2,6-diphenylphenyl)phosphinine.
| Compound Name | 2,6-ditert-butyl-4-(2,6-diphenylphenyl)phosphinine |
|---|---|
| PubChem CID | 5013068 |
| Molecular Formula | C31H33P |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 2,6-ditert-butyl-4-(2,6-diphenylphenyl)phosphinine |
| SMILES | CC(C)(C)c1cc(-c2c(-c3ccccc3)cccc2-c2ccccc2)cc(C(C)(C)C)p1 |
| InChI | InChI=1S/C31H33P/c1-30(2,3)27-20-24(21-28(32-27)31(4,5)6)29-25(22-14-9-7-10-15-22)18-13-19-26(29)23-16-11-8-12-17-23/h7-21H,1-6H3 |
| InChIKey | SDXPBIVHPYDJQH-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |