C19H17F6OPS — CID 139668429
(4-methoxy-2,3-diphenylphenyl)sulfanium hexafluorophosphate (PubChem CID 139668429) has the molecular formula C19H17F6OPS and a molecular weight of 438.37 g/mol. Its IUPAC name is (4-methoxy-2,3-diphenylphenyl)sulfanium hexafluorophosphate.
| Compound Name | (4-methoxy-2,3-diphenylphenyl)sulfanium hexafluorophosphate |
|---|---|
| PubChem CID | 139668429 |
| Molecular Formula | C19H17F6OPS |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | (4-methoxy-2,3-diphenylphenyl)sulfanium hexafluorophosphate |
| SMILES | COc1ccc([SH2+])c(-c2ccccc2)c1-c1ccccc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C19H16OS.F6P/c1-20-16-12-13-17(21)19(15-10-6-3-7-11-15)18(16)14-8-4-2-5-9-14;1-7(2,3,4,5)6/h2-13,21H,1H3;/q;-1/p+1 |
| InChIKey | ILZIRLZBQKWWRV-UHFFFAOYSA-O |
| XLogP | 7.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|