About methyl benzoate;(sulfamoylamino)benzene
methyl benzoate;(sulfamoylamino)benzene (PubChem CID 174928336) has the molecular formula C14H16N2O4S
and a molecular weight of 308.36 g/mol. Its IUPAC name is methyl benzoate;(sulfamoylamino)benzene.
Molecular Properties
| Compound Name | methyl benzoate;(sulfamoylamino)benzene |
| PubChem CID | 174928336 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | methyl benzoate;(sulfamoylamino)benzene |
| SMILES | COC(=O)c1ccccc1.NS(=O)(=O)Nc1ccccc1 |
| InChI | InChI=1S/C8H8O2.C6H8N2O2S/c1-10-8(9)7-5-3-2-4-6-7;7-11(9,10)8-6-4-2-1-3-5-6/h2-6H,1H3;1-5,8H,(H2,7,9,10) |
| InChIKey | YMXAJBSYIQHTSN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl benzoate;(sulfamoylamino)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl benzoate;(sulfamoylamino)benzene?
The IUPAC name of methyl benzoate;(sulfamoylamino)benzene (CID 174928336) is methyl benzoate;(sulfamoylamino)benzene.
What is the SMILES notation for methyl benzoate;(sulfamoylamino)benzene?
The canonical SMILES for methyl benzoate;(sulfamoylamino)benzene is COC(=O)c1ccccc1.NS(=O)(=O)Nc1ccccc1.
What is the InChIKey of methyl benzoate;(sulfamoylamino)benzene?
The InChIKey is YMXAJBSYIQHTSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C6H8N2O2S/c1-10-8(9)7-5-3-2-4-6-7;7-11(9,10)8-6-4-2-1-3-5-6/h2-6H,1H3;1-5,8H,(H2,7,9,10).
What are the key properties of methyl benzoate;(sulfamoylamino)benzene?
methyl benzoate;(sulfamoylamino)benzene has a molecular weight of 308.36 g/mol, XLogP of 1.78, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl benzoate;(sulfamoylamino)benzene is sourced from PubChem (CID 174928336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).