C13H14BrNO4 — CID 155735210
3-bromoaniline;2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione (PubChem CID 155735210) has the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. Its IUPAC name is 3-bromoaniline;2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione.
| Compound Name | 3-bromoaniline;2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 155735210 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 3-bromoaniline;2,2-dimethyl-5-methylidene-1,3-dioxane-4,6-dione |
| SMILES | C=C1C(=O)OC(C)(C)OC1=O.Nc1cccc(Br)c1 |
| InChI | InChI=1S/C7H8O4.C6H6BrN/c1-4-5(8)10-7(2,3)11-6(4)9;7-5-2-1-3-6(8)4-5/h1H2,2-3H3;1-4H,8H2 |
| InChIKey | KZLXDQWGFDLPAS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|