C20H18Br2O4 — CID 3947567
5,5-bis[(3-bromophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 3947567) has the molecular formula C20H18Br2O4 and a molecular weight of 482.17 g/mol. Its IUPAC name is 5,5-bis[(3-bromophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5,5-bis[(3-bromophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 3947567 |
| Molecular Formula | C20H18Br2O4 |
| Molecular Weight | 482.17 g/mol |
| Exact Mass | 479.96 |
| IUPAC Name | 5,5-bis[(3-bromophenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(Cc2cccc(Br)c2)(Cc2cccc(Br)c2)C(=O)O1 |
| InChI | InChI=1S/C20H18Br2O4/c1-19(2)25-17(23)20(18(24)26-19,11-13-5-3-7-15(21)9-13)12-14-6-4-8-16(22)10-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | SKHZOIPGUGTWBE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.17 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|