C20H17Br2FO4 — CID 122234320
dimethyl 2-[(E,1R)-1,3-bis(3-bromophenyl)prop-2-enyl]-2-fluoropropanedioate (PubChem CID 122234320) has the molecular formula C20H17Br2FO4 and a molecular weight of 500.16 g/mol. Its IUPAC name is dimethyl 2-[(E,1R)-1,3-bis(3-bromophenyl)prop-2-enyl]-2-fluoropropanedioate.
| Compound Name | dimethyl 2-[(E,1R)-1,3-bis(3-bromophenyl)prop-2-enyl]-2-fluoropropanedioate |
|---|---|
| PubChem CID | 122234320 |
| Molecular Formula | C20H17Br2FO4 |
| Molecular Weight | 500.16 g/mol |
| Exact Mass | 497.95 |
| IUPAC Name | dimethyl 2-[(E,1R)-1,3-bis(3-bromophenyl)prop-2-enyl]-2-fluoropropanedioate |
| SMILES | COC(=O)C(F)(C(=O)OC)[C@H](/C=C/c1cccc(Br)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C20H17Br2FO4/c1-26-18(24)20(23,19(25)27-2)17(14-6-4-8-16(22)12-14)10-9-13-5-3-7-15(21)11-13/h3-12,17H,1-2H3/b10-9+/t17-/m1/s1 |
| InChIKey | DKYOOBPFQRRZTK-OAGJVSPASA-N |
| XLogP | 5.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.16 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|