C12H6BaBr4O6S2 — CID 139842157
barium(2+);bis(3,4-dibromobenzenesulfonate) (PubChem CID 139842157) has the molecular formula C12H6BaBr4O6S2 and a molecular weight of 767.25 g/mol. Its IUPAC name is barium(2+);bis(3,4-dibromobenzenesulfonate).
| Compound Name | barium(2+);bis(3,4-dibromobenzenesulfonate) |
|---|---|
| PubChem CID | 139842157 |
| Molecular Formula | C12H6BaBr4O6S2 |
| Molecular Weight | 767.25 g/mol |
| Exact Mass | 763.54 |
| IUPAC Name | barium(2+);bis(3,4-dibromobenzenesulfonate) |
| SMILES | O=S(=O)([O-])c1ccc(Br)c(Br)c1.O=S(=O)([O-])c1ccc(Br)c(Br)c1.[Ba+2] |
| InChI | InChI=1S/2C6H4Br2O3S.Ba/c2*7-5-2-1-4(3-6(5)8)12(9,10)11;/h2*1-3H,(H,9,10,11);/q;;+2/p-2 |
| InChIKey | DLELDTDOEGNHQQ-UHFFFAOYSA-L |
| XLogP | 3.85 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|