C6H3Br2KO3S — CID 139842221
potassium 3,4-dibromobenzenesulfonate (PubChem CID 139842221) has the molecular formula C6H3Br2KO3S and a molecular weight of 354.06 g/mol. Its IUPAC name is potassium 3,4-dibromobenzenesulfonate.
| Compound Name | potassium 3,4-dibromobenzenesulfonate |
|---|---|
| PubChem CID | 139842221 |
| Molecular Formula | C6H3Br2KO3S |
| Molecular Weight | 354.06 g/mol |
| Exact Mass | 351.78 |
| IUPAC Name | potassium 3,4-dibromobenzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(Br)c(Br)c1.[K+] |
| InChI | InChI=1S/C6H4Br2O3S.K/c7-5-2-1-4(3-6(5)8)12(9,10)11;/h1-3H,(H,9,10,11);/q;+1/p-1 |
| InChIKey | JUYAMRPWRJMWLD-UHFFFAOYSA-M |
| XLogP | -0.88 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.06 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|