C6H2Br2NO4S- — CID 3272370
3,5-dibromo-4-nitrosobenzenesulfonate (PubChem CID 3272370) has the molecular formula C6H2Br2NO4S- and a molecular weight of 343.96 g/mol. Its IUPAC name is 3,5-dibromo-4-nitrosobenzenesulfonate.
| Compound Name | 3,5-dibromo-4-nitrosobenzenesulfonate |
|---|---|
| PubChem CID | 3272370 |
| Molecular Formula | C6H2Br2NO4S- |
| Molecular Weight | 343.96 g/mol |
| Exact Mass | 341.81 |
| IUPAC Name | 3,5-dibromo-4-nitrosobenzenesulfonate |
| SMILES | O=Nc1c(Br)cc(S(=O)(=O)[O-])cc1Br |
| InChI | InChI=1S/C6H3Br2NO4S/c7-4-1-3(14(11,12)13)2-5(8)6(4)9-10/h1-2H,(H,11,12,13)/p-1 |
| InChIKey | NTFXNXQDQBCQSU-UHFFFAOYSA-M |
| XLogP | 2.51 |
| TPSA | 86.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.96 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|