C7H7NO6S2-2 — CID 147455623
5-(methylamino)benzene-1,3-disulfonate (PubChem CID 147455623) has the molecular formula C7H7NO6S2-2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 5-(methylamino)benzene-1,3-disulfonate.
| Compound Name | 5-(methylamino)benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 147455623 |
| Molecular Formula | C7H7NO6S2-2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | 5-(methylamino)benzene-1,3-disulfonate |
| SMILES | CNc1cc(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C7H9NO6S2/c1-8-5-2-6(15(9,10)11)4-7(3-5)16(12,13)14/h2-4,8H,1H3,(H,9,10,11)(H,12,13,14)/p-2 |
| InChIKey | BWQZBFFZDKFHDI-UHFFFAOYSA-L |
| XLogP | -0.46 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|