C21H25NO2 — CID 160768568
ethane;3-hydroxy-7-methyl-N-phenylnaphthalene-2-carboxamide;methane (PubChem CID 160768568) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is ethane;3-hydroxy-7-methyl-N-phenylnaphthalene-2-carboxamide;methane.
| Compound Name | ethane;3-hydroxy-7-methyl-N-phenylnaphthalene-2-carboxamide;methane |
|---|---|
| PubChem CID | 160768568 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | ethane;3-hydroxy-7-methyl-N-phenylnaphthalene-2-carboxamide;methane |
| SMILES | C.CC.Cc1ccc2cc(O)c(C(=O)Nc3ccccc3)cc2c1 |
| InChI | InChI=1S/C18H15NO2.C2H6.CH4/c1-12-7-8-13-11-17(20)16(10-14(13)9-12)18(21)19-15-5-3-2-4-6-15;1-2;/h2-11,20H,1H3,(H,19,21);1-2H3;1H4 |
| InChIKey | RYZXFZOQFOOFLU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |