C13H8Br3NOS — CID 27451
3,5-dibromo-N-(4-bromophenyl)-2-sulfanylbenzamide (PubChem CID 27451) has the molecular formula C13H8Br3NOS and a molecular weight of 465.99 g/mol. Its IUPAC name is 3,5-dibromo-N-(4-bromophenyl)-2-sulfanylbenzamide.
| Compound Name | 3,5-dibromo-N-(4-bromophenyl)-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 27451 |
| Molecular Formula | C13H8Br3NOS |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 462.79 |
| IUPAC Name | 3,5-dibromo-N-(4-bromophenyl)-2-sulfanylbenzamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1cc(Br)cc(Br)c1S |
| InChI | InChI=1S/C13H8Br3NOS/c14-7-1-3-9(4-2-7)17-13(18)10-5-8(15)6-11(16)12(10)19/h1-6,19H,(H,17,18) |
| InChIKey | OKHDITLYENFQED-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|