C22H18Br2N2O2S2 — CID 4604381
5-bromo-N-[4-[(5-bromo-2-methylsulfanylbenzoyl)amino]phenyl]-2-methylsulfanylbenzamide (PubChem CID 4604381) has the molecular formula C22H18Br2N2O2S2 and a molecular weight of 566.34 g/mol. Its IUPAC name is 5-bromo-N-[4-[(5-bromo-2-methylsulfanylbenzoyl)amino]phenyl]-2-methylsulfanylbenzamide.
| Compound Name | 5-bromo-N-[4-[(5-bromo-2-methylsulfanylbenzoyl)amino]phenyl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 4604381 |
| Molecular Formula | C22H18Br2N2O2S2 |
| Molecular Weight | 566.34 g/mol |
| Exact Mass | 563.92 |
| IUPAC Name | 5-bromo-N-[4-[(5-bromo-2-methylsulfanylbenzoyl)amino]phenyl]-2-methylsulfanylbenzamide |
| SMILES | CSc1ccc(Br)cc1C(=O)Nc1ccc(NC(=O)c2cc(Br)ccc2SC)cc1 |
| InChI | InChI=1S/C22H18Br2N2O2S2/c1-29-19-9-3-13(23)11-17(19)21(27)25-15-5-7-16(8-6-15)26-22(28)18-12-14(24)4-10-20(18)30-2/h3-12H,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | DEDJKCOEKAMHFI-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.34 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |