About 4-cyclopropylpyrene
4-cyclopropylpyrene (PubChem CID 151298183) has the molecular formula C19H14
and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-cyclopropylpyrene.
Molecular Properties
| Compound Name | 4-cyclopropylpyrene |
| PubChem CID | 151298183 |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-cyclopropylpyrene |
| SMILES | c1cc2ccc3cccc4c(C5CC5)cc(c1)c2c34 |
| InChI | InChI=1S/C19H14/c1-3-13-9-10-14-4-2-6-16-17(12-7-8-12)11-15(5-1)18(13)19(14)16/h1-6,9-12H,7-8H2 |
| InChIKey | OBVVLPDTKALDBD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopropylpyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropylpyrene?
The IUPAC name of 4-cyclopropylpyrene (CID 151298183) is 4-cyclopropylpyrene.
What is the SMILES notation for 4-cyclopropylpyrene?
The canonical SMILES for 4-cyclopropylpyrene is c1cc2ccc3cccc4c(C5CC5)cc(c1)c2c34.
What is the InChIKey of 4-cyclopropylpyrene?
The InChIKey is OBVVLPDTKALDBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14/c1-3-13-9-10-14-4-2-6-16-17(12-7-8-12)11-15(5-1)18(13)19(14)16/h1-6,9-12H,7-8H2.
What are the key properties of 4-cyclopropylpyrene?
4-cyclopropylpyrene has a molecular weight of 242.32 g/mol, XLogP of 5.46, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropylpyrene is sourced from PubChem (CID 151298183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).