C18H10O — CID 24848491
(2S,4R)-3-oxahexacyclo[13.3.1.02,4.05,18.08,17.011,16]nonadeca-1(19),5(18),6,8(17),9,11(16),12,14-octaene (PubChem CID 24848491) has the molecular formula C18H10O and a molecular weight of 242.28 g/mol. Its IUPAC name is (2S,4R)-3-oxahexacyclo[13.3.1.02,4.05,18.08,17.011,16]nonadeca-1(19),5(18),6,8(17),9,11(16),12,14-octaene.
| Compound Name | (2S,4R)-3-oxahexacyclo[13.3.1.02,4.05,18.08,17.011,16]nonadeca-1(19),5(18),6,8(17),9,11(16),12,14-octaene |
|---|---|
| PubChem CID | 24848491 |
| Molecular Formula | C18H10O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (2S,4R)-3-oxahexacyclo[13.3.1.02,4.05,18.08,17.011,16]nonadeca-1(19),5(18),6,8(17),9,11(16),12,14-octaene |
| SMILES | c1cc2ccc3ccc4c5c(cc(c1)c2c35)[C@@H]1O[C@H]41 |
| InChI | InChI=1S/C18H10O/c1-2-9-4-5-10-6-7-12-16-13(18-17(12)19-18)8-11(3-1)14(9)15(10)16/h1-8,17-18H/t17-,18+/m1/s1 |
| InChIKey | IHWWMRTWJKYVEY-MSOLQXFVSA-N |
| XLogP | 4.71 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|