About 1-cyclopentylpyrene
1-cyclopentylpyrene (PubChem CID 101173318) has the molecular formula C21H18
and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-cyclopentylpyrene.
Molecular Properties
| Compound Name | 1-cyclopentylpyrene |
| PubChem CID | 101173318 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-cyclopentylpyrene |
| SMILES | c1cc2ccc3ccc(C4CCCC4)c4ccc(c1)c2c34 |
| InChI | InChI=1S/C21H18/c1-2-5-14(4-1)18-12-10-17-9-8-15-6-3-7-16-11-13-19(18)21(17)20(15)16/h3,6-14H,1-2,4-5H2 |
| InChIKey | UOKGXDQMRWPXAZ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentylpyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylpyrene?
The IUPAC name of 1-cyclopentylpyrene (CID 101173318) is 1-cyclopentylpyrene.
What is the SMILES notation for 1-cyclopentylpyrene?
The canonical SMILES for 1-cyclopentylpyrene is c1cc2ccc3ccc(C4CCCC4)c4ccc(c1)c2c34.
What is the InChIKey of 1-cyclopentylpyrene?
The InChIKey is UOKGXDQMRWPXAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18/c1-2-5-14(4-1)18-12-10-17-9-8-15-6-3-7-16-11-13-19(18)21(17)20(15)16/h3,6-14H,1-2,4-5H2.
What are the key properties of 1-cyclopentylpyrene?
1-cyclopentylpyrene has a molecular weight of 270.38 g/mol, XLogP of 6.24, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylpyrene is sourced from PubChem (CID 101173318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).