C19H13NO2 — CID 171184795
(4R)-4-pyren-1-yl-1,3-oxazolidin-2-one (PubChem CID 171184795) has the molecular formula C19H13NO2 and a molecular weight of 287.32 g/mol. Its IUPAC name is (4R)-4-pyren-1-yl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-pyren-1-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 171184795 |
| Molecular Formula | C19H13NO2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | (4R)-4-pyren-1-yl-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@H](c2ccc3ccc4cccc5ccc2c3c45)CO1 |
| InChI | InChI=1S/C19H13NO2/c21-19-20-16(10-22-19)14-8-6-13-5-4-11-2-1-3-12-7-9-15(14)18(13)17(11)12/h1-9,16H,10H2,(H,20,21)/t16-/m0/s1 |
| InChIKey | VWHMPEXJARFNDW-INIZCTEOSA-N |
| XLogP | 4.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|