C18H16O3 — CID 5326482
(2R,3S,4R)-1,2,3,4-tetrahydrobenzo[a]anthracene-2,3,4-triol (PubChem CID 5326482) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2R,3S,4R)-1,2,3,4-tetrahydrobenzo[a]anthracene-2,3,4-triol.
| Compound Name | (2R,3S,4R)-1,2,3,4-tetrahydrobenzo[a]anthracene-2,3,4-triol |
|---|---|
| PubChem CID | 5326482 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (2R,3S,4R)-1,2,3,4-tetrahydrobenzo[a]anthracene-2,3,4-triol |
| SMILES | O[C@H]1[C@H](O)Cc2c(ccc3cc4ccccc4cc23)[C@H]1O |
| InChI | InChI=1S/C18H16O3/c19-16-9-15-13(17(20)18(16)21)6-5-12-7-10-3-1-2-4-11(10)8-14(12)15/h1-8,16-21H,9H2/t16-,17-,18+/m1/s1 |
| InChIKey | XKOJNRIIGYARBJ-KURKYZTESA-N |
| XLogP | 2.30 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|