C18H16O2 — CID 12601821
1,2,3,4-tetrahydrobenzo[a]anthracene-3,4-diol (PubChem CID 12601821) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1,2,3,4-tetrahydrobenzo[a]anthracene-3,4-diol.
| Compound Name | 1,2,3,4-tetrahydrobenzo[a]anthracene-3,4-diol |
|---|---|
| PubChem CID | 12601821 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1,2,3,4-tetrahydrobenzo[a]anthracene-3,4-diol |
| SMILES | OC1CCc2c(ccc3cc4ccccc4cc23)C1O |
| InChI | InChI=1S/C18H16O2/c19-17-8-7-14-15(18(17)20)6-5-13-9-11-3-1-2-4-12(11)10-16(13)14/h1-6,9-10,17-20H,7-8H2 |
| InChIKey | TWMOMMCFHGETNT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|