C20H19BrO3 — CID 71423199
acetic acid;(1R,2R)-2-bromo-1,2,3,4-tetrahydrobenzo[a]anthracen-1-ol (PubChem CID 71423199) has the molecular formula C20H19BrO3 and a molecular weight of 387.27 g/mol. Its IUPAC name is acetic acid;(1R,2R)-2-bromo-1,2,3,4-tetrahydrobenzo[a]anthracen-1-ol.
| Compound Name | acetic acid;(1R,2R)-2-bromo-1,2,3,4-tetrahydrobenzo[a]anthracen-1-ol |
|---|---|
| PubChem CID | 71423199 |
| Molecular Formula | C20H19BrO3 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | acetic acid;(1R,2R)-2-bromo-1,2,3,4-tetrahydrobenzo[a]anthracen-1-ol |
| SMILES | CC(=O)O.O[C@@H]1c2c(ccc3cc4ccccc4cc23)CC[C@H]1Br |
| InChI | InChI=1S/C18H15BrO.C2H4O2/c19-16-8-7-11-5-6-14-9-12-3-1-2-4-13(12)10-15(14)17(11)18(16)20;1-2(3)4/h1-6,9-10,16,18,20H,7-8H2;1H3,(H,3,4)/t16-,18+;/m1./s1 |
| InChIKey | BQCBGAIIRIWPMB-CLRXKPRGSA-N |
| XLogP | 4.83 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|