C20H16O6S — CID 21122756
(8S,9S)-7,8,9-trihydroxy-7,8,9,10-tetrahydrobenzo[a]pyrene-10-sulfonic acid (PubChem CID 21122756) has the molecular formula C20H16O6S and a molecular weight of 384.41 g/mol. Its IUPAC name is (8S,9S)-7,8,9-trihydroxy-7,8,9,10-tetrahydrobenzo[a]pyrene-10-sulfonic acid.
| Compound Name | (8S,9S)-7,8,9-trihydroxy-7,8,9,10-tetrahydrobenzo[a]pyrene-10-sulfonic acid |
|---|---|
| PubChem CID | 21122756 |
| Molecular Formula | C20H16O6S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | (8S,9S)-7,8,9-trihydroxy-7,8,9,10-tetrahydrobenzo[a]pyrene-10-sulfonic acid |
| SMILES | O=S(=O)(O)C1c2c(cc3ccc4cccc5ccc2c3c45)C(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H16O6S/c21-17-13-8-11-5-4-9-2-1-3-10-6-7-12(15(11)14(9)10)16(13)20(27(24,25)26)19(23)18(17)22/h1-8,17-23H,(H,24,25,26)/t17?,18-,19-,20?/m0/s1 |
| InChIKey | GTWWVQRQJNLCLW-NUVZVAJJSA-N |
| XLogP | 2.28 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|