C30H27N5O6 — CID 14428888
(7S,8R,9R,10S)-10-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-7,8,9,10-tetrahydrobenzo[a]pyrene-7,8,9-triol (PubChem CID 14428888) has the molecular formula C30H27N5O6 and a molecular weight of 553.58 g/mol. Its IUPAC name is (7S,8R,9R,10S)-10-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-7,8,9,10-tetrahydrobenzo[a]pyrene-7,8,9-triol.
| Compound Name | (7S,8R,9R,10S)-10-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-7,8,9,10-tetrahydrobenzo[a]pyrene-7,8,9-triol |
|---|---|
| PubChem CID | 14428888 |
| Molecular Formula | C30H27N5O6 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | (7S,8R,9R,10S)-10-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-7,8,9,10-tetrahydrobenzo[a]pyrene-7,8,9-triol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(N[C@H]4c5c(cc6ccc7cccc8ccc5c6c78)[C@H](O)[C@@H](O)[C@@H]4O)ncnc32)C[C@@H]1O |
| InChI | InChI=1S/C30H27N5O6/c36-10-19-18(37)9-20(41-19)35-12-33-25-29(31-11-32-30(25)35)34-24-23-16-7-6-14-3-1-2-13-4-5-15(22(16)21(13)14)8-17(23)26(38)28(40)27(24)39/h1-8,11-12,18-20,24,26-28,36-40H,9-10H2,(H,31,32,34)/t18-,19+,20+,24-,26-,27+,28+/m0/s1 |
| InChIKey | CTZMKJGEZSMRHR-ZLEMKJBPSA-N |
| XLogP | 2.29 |
| TPSA | 166.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|