C30H21N5O5 — CID 102210770
10-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]benzo[a]pyrene-7,8-dione (PubChem CID 102210770) has the molecular formula C30H21N5O5 and a molecular weight of 531.53 g/mol. Its IUPAC name is 10-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]benzo[a]pyrene-7,8-dione.
| Compound Name | 10-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]benzo[a]pyrene-7,8-dione |
|---|---|
| PubChem CID | 102210770 |
| Molecular Formula | C30H21N5O5 |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 10-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]benzo[a]pyrene-7,8-dione |
| SMILES | O=c1cc(Nc2ncnc3c2ncn3[C@H]2C[C@H](O)[C@@H](CO)O2)c2c(cc3ccc4cccc5ccc2c3c45)c1=O |
| InChI | InChI=1S/C30H21N5O5/c36-11-22-20(37)10-23(40-22)35-13-33-27-29(31-12-32-30(27)35)34-19-9-21(38)28(39)18-8-16-5-4-14-2-1-3-15-6-7-17(26(18)19)25(16)24(14)15/h1-9,12-13,20,22-23,36-37H,10-11H2,(H,31,32,34)/t20-,22+,23+/m0/s1 |
| InChIKey | OVDAWVQENBTMQZ-MDNUFGMLSA-N |
| XLogP | 3.42 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|