C30H28N5O9P — CID 10746613
[(2R,3S,5R)-2-(hydroxymethyl)-5-[6-[[(7R,8S,9R,10R)-7,8,9-trihydroxy-7,8,9,10-tetrahydrobenzo[a]pyren-10-yl]amino]purin-9-yl]oxolan-3-yl] dihydrogen phosphate (PubChem CID 10746613) has the molecular formula C30H28N5O9P and a molecular weight of 633.55 g/mol. Its IUPAC name is [(2R,3S,5R)-2-(hydroxymethyl)-5-[6-[[(7R,8S,9R,10R)-7,8,9-trihydroxy-7,8,9,10-tetrahydrobenzo[a]pyren-10-yl]amino]purin-9-yl]oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-2-(hydroxymethyl)-5-[6-[[(7R,8S,9R,10R)-7,8,9-trihydroxy-7,8,9,10-tetrahydrobenzo[a]pyren-10-yl]amino]purin-9-yl]oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10746613 |
| Molecular Formula | C30H28N5O9P |
| Molecular Weight | 633.55 g/mol |
| Exact Mass | 633.16 |
| IUPAC Name | [(2R,3S,5R)-2-(hydroxymethyl)-5-[6-[[(7R,8S,9R,10R)-7,8,9-trihydroxy-7,8,9,10-tetrahydrobenzo[a]pyren-10-yl]amino]purin-9-yl]oxolan-3-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)O[C@H]1C[C@H](n2cnc3c(N[C@@H]4c5c(cc6ccc7cccc8ccc5c6c78)[C@@H](O)[C@H](O)[C@@H]4O)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C30H28N5O9P/c36-10-19-18(44-45(40,41)42)9-20(43-19)35-12-33-25-29(31-11-32-30(25)35)34-24-23-16-7-6-14-3-1-2-13-4-5-15(22(16)21(13)14)8-17(23)26(37)28(39)27(24)38/h1-8,11-12,18-20,24,26-28,36-39H,9-10H2,(H,31,32,34)(H2,40,41,42)/t18-,19+,20+,24+,26+,27+,28-/m0/s1 |
| InChIKey | LQLSCKJFGPBJDR-MPMHOAOYSA-N |
| XLogP | 2.40 |
| TPSA | 212.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|