C30H28N5O10P — CID 136763063
[(2R,3S,5R)-3-hydroxy-5-[6-oxo-2-[[(7R,8S,9R,10S)-7,8,9-trihydroxy-7,8,9,10-tetrahydrobenzo[a]pyren-10-yl]amino]-1H-purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 136763063) has the molecular formula C30H28N5O10P and a molecular weight of 649.55 g/mol. Its IUPAC name is [(2R,3S,5R)-3-hydroxy-5-[6-oxo-2-[[(7R,8S,9R,10S)-7,8,9-trihydroxy-7,8,9,10-tetrahydrobenzo[a]pyren-10-yl]amino]-1H-purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-3-hydroxy-5-[6-oxo-2-[[(7R,8S,9R,10S)-7,8,9-trihydroxy-7,8,9,10-tetrahydrobenzo[a]pyren-10-yl]amino]-1H-purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 136763063 |
| Molecular Formula | C30H28N5O10P |
| Molecular Weight | 649.55 g/mol |
| Exact Mass | 649.16 |
| IUPAC Name | [(2R,3S,5R)-3-hydroxy-5-[6-oxo-2-[[(7R,8S,9R,10S)-7,8,9-trihydroxy-7,8,9,10-tetrahydrobenzo[a]pyren-10-yl]amino]-1H-purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1[nH]c(N[C@H]2c3c(cc4ccc5cccc6ccc3c4c56)[C@@H](O)[C@H](O)[C@@H]2O)nc2c1ncn2[C@H]1C[C@H](O)[C@@H](COP(=O)(O)O)O1 |
| InChI | InChI=1S/C30H28N5O10P/c36-17-9-19(45-18(17)10-44-46(41,42)43)35-11-31-24-28(35)33-30(34-29(24)40)32-23-22-15-7-6-13-3-1-2-12-4-5-14(21(15)20(12)13)8-16(22)25(37)27(39)26(23)38/h1-8,11,17-19,23,25-27,36-39H,9-10H2,(H2,41,42,43)(H2,32,33,34,40)/t17-,18+,19+,23-,25+,26+,27-/m0/s1 |
| InChIKey | IKLPJCZKMODXAH-KCAXFQNZSA-N |
| XLogP | 1.70 |
| TPSA | 232.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.55 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|