C30H31N5O7 — CID 136714703
9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(1,2,3-trihydroxy-5,6-dimethyl-1,2,3,4-tetrahydrochrysen-4-yl)amino]-1H-purin-6-one (PubChem CID 136714703) has the molecular formula C30H31N5O7 and a molecular weight of 573.61 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(1,2,3-trihydroxy-5,6-dimethyl-1,2,3,4-tetrahydrochrysen-4-yl)amino]-1H-purin-6-one.
| Compound Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(1,2,3-trihydroxy-5,6-dimethyl-1,2,3,4-tetrahydrochrysen-4-yl)amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 136714703 |
| Molecular Formula | C30H31N5O7 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(1,2,3-trihydroxy-5,6-dimethyl-1,2,3,4-tetrahydrochrysen-4-yl)amino]-1H-purin-6-one |
| SMILES | Cc1c(C)c2c3c(ccc2c2ccccc12)C(O)C(O)C(O)C3Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C30H31N5O7/c1-12-13(2)21-16(15-6-4-3-5-14(12)15)7-8-17-22(21)23(26(39)27(40)25(17)38)32-30-33-28-24(29(41)34-30)31-11-35(28)20-9-18(37)19(10-36)42-20/h3-8,11,18-20,23,25-27,36-40H,9-10H2,1-2H3,(H2,32,33,34,41)/t18-,19+,20+,23?,25?,26?,27?/m0/s1 |
| InChIKey | BTCPBWQHXXAWRZ-MXSPZODLSA-N |
| XLogP | 1.61 |
| TPSA | 185.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|