C29H23N5O6 — CID 135693541
1-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]amino]-7-methylbenzo[a]anthracene-3,4-dione (PubChem CID 135693541) has the molecular formula C29H23N5O6 and a molecular weight of 537.53 g/mol. Its IUPAC name is 1-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]amino]-7-methylbenzo[a]anthracene-3,4-dione.
| Compound Name | 1-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]amino]-7-methylbenzo[a]anthracene-3,4-dione |
|---|---|
| PubChem CID | 135693541 |
| Molecular Formula | C29H23N5O6 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 1-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]amino]-7-methylbenzo[a]anthracene-3,4-dione |
| SMILES | Cc1c2ccccc2cc2c3c(ccc12)C(=O)C(=O)C=C3Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C29H23N5O6/c1-13-15-5-3-2-4-14(15)8-18-16(13)6-7-17-24(18)19(9-21(37)26(17)38)31-29-32-27-25(28(39)33-29)30-12-34(27)23-10-20(36)22(11-35)40-23/h2-9,12,20,22-23,35-36H,10-11H2,1H3,(H2,31,32,33,39)/t20-,22+,23+/m0/s1 |
| InChIKey | QMQSIRPAHRJVRY-MDNUFGMLSA-N |
| XLogP | 2.59 |
| TPSA | 159.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|