C30H26N6O10 — CID 137171681
9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(7,8,9-trihydroxy-3-nitro-7,8,9,10-tetrahydrobenzo[a]pyren-10-yl)amino]-1H-purin-6-one (PubChem CID 137171681) has the molecular formula C30H26N6O10 and a molecular weight of 630.57 g/mol. Its IUPAC name is 9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(7,8,9-trihydroxy-3-nitro-7,8,9,10-tetrahydrobenzo[a]pyren-10-yl)amino]-1H-purin-6-one.
| Compound Name | 9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(7,8,9-trihydroxy-3-nitro-7,8,9,10-tetrahydrobenzo[a]pyren-10-yl)amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 137171681 |
| Molecular Formula | C30H26N6O10 |
| Molecular Weight | 630.57 g/mol |
| Exact Mass | 630.17 |
| IUPAC Name | 9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(7,8,9-trihydroxy-3-nitro-7,8,9,10-tetrahydrobenzo[a]pyren-10-yl)amino]-1H-purin-6-one |
| SMILES | O=c1[nH]c(NC2c3c(cc4ccc5c([N+](=O)[O-])ccc6ccc3c4c65)C(O)C(O)C2O)nc2c1ncn2C1OC(CO)C(O)C1O |
| InChI | InChI=1S/C30H26N6O10/c37-8-16-23(39)26(42)29(46-16)35-9-31-21-27(35)33-30(34-28(21)43)32-20-19-13-5-1-10-3-6-15(36(44)45)12-4-2-11(18(13)17(10)12)7-14(19)22(38)25(41)24(20)40/h1-7,9,16,20,22-26,29,37-42H,8H2,(H2,32,33,34,43) |
| InChIKey | UYMXAXXGEVCREJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 249.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.57 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|