C19H17+ — CID 15498399
11,17-dimethyl-15,16-dihydrocyclopenta[a]phenanthren-17-ylium (PubChem CID 15498399) has the molecular formula C19H17+ and a molecular weight of 245.34 g/mol. Its IUPAC name is 11,17-dimethyl-15,16-dihydrocyclopenta[a]phenanthren-17-ylium.
| Compound Name | 11,17-dimethyl-15,16-dihydrocyclopenta[a]phenanthren-17-ylium |
|---|---|
| PubChem CID | 15498399 |
| Molecular Formula | C19H17+ |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 11,17-dimethyl-15,16-dihydrocyclopenta[a]phenanthren-17-ylium |
| SMILES | Cc1cc2c(c3ccc4ccccc4c13)CC[C+]2C |
| InChI | InChI=1S/C19H17/c1-12-7-9-16-17-10-8-14-5-3-4-6-15(14)19(17)13(2)11-18(12)16/h3-6,8,10-11H,7,9H2,1-2H3/q+1 |
| InChIKey | XGWDZTBGMBUSCZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|