C22H24 — CID 625666
11-butyl-1,2,3,4-tetrahydrochrysene (PubChem CID 625666) has the molecular formula C22H24 and a molecular weight of 288.43 g/mol. Its IUPAC name is 11-butyl-1,2,3,4-tetrahydrochrysene.
| Compound Name | 11-butyl-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 625666 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 11-butyl-1,2,3,4-tetrahydrochrysene |
| SMILES | CCCCc1cc2c(c3ccc4ccccc4c13)CCCC2 |
| InChI | InChI=1S/C22H24/c1-2-3-8-18-15-17-10-5-6-11-19(17)21-14-13-16-9-4-7-12-20(16)22(18)21/h4,7,9,12-15H,2-3,5-6,8,10-11H2,1H3 |
| InChIKey | RZDYMMWZEZPGDV-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|