C21H16 — CID 3063315
pentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(21),2(11),3,5,7,9,12,14,16-nonaene (PubChem CID 3063315) has the molecular formula C21H16 and a molecular weight of 268.36 g/mol. Its IUPAC name is pentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(21),2(11),3,5,7,9,12,14,16-nonaene.
| Compound Name | pentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(21),2(11),3,5,7,9,12,14,16-nonaene |
|---|---|
| PubChem CID | 3063315 |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | pentacyclo[11.7.1.02,11.05,10.017,21]henicosa-1(21),2(11),3,5,7,9,12,14,16-nonaene |
| SMILES | c1cc2c3c(c4ccc5ccccc5c4cc3c1)CCC2 |
| InChI | InChI=1S/C21H16/c1-2-9-17-14(5-1)11-12-18-19-10-4-7-15-6-3-8-16(21(15)19)13-20(17)18/h1-3,5-6,8-9,11-13H,4,7,10H2 |
| InChIKey | LOIGUFIVQGDJRT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|